C28H22FN3O5 — CID 126252235
(5Z)-1-(2,4-dimethoxyphenyl)-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126252235) has the molecular formula C28H22FN3O5 and a molecular weight of 499.50 g/mol. Its IUPAC name is (5Z)-1-(2,4-dimethoxyphenyl)-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(2,4-dimethoxyphenyl)-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126252235 |
| Molecular Formula | C28H22FN3O5 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (5Z)-1-(2,4-dimethoxyphenyl)-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)/C(=C/c3ccc4c(ccn4Cc4cccc(F)c4)c3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C28H22FN3O5/c1-36-21-7-9-24(25(15-21)37-2)32-27(34)22(26(33)30-28(32)35)14-17-6-8-23-19(12-17)10-11-31(23)16-18-4-3-5-20(29)13-18/h3-15H,16H2,1-2H3,(H,30,33,35)/b22-14- |
| InChIKey | DFDWTHFAWVKNFG-HMAPJEAMSA-N |
| XLogP | 4.51 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|