C36H32FN3O3 — CID 126235534
(5Z)-1-[4-(1-adamantyl)phenyl]-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126235534) has the molecular formula C36H32FN3O3 and a molecular weight of 573.67 g/mol. Its IUPAC name is (5Z)-1-[4-(1-adamantyl)phenyl]-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-[4-(1-adamantyl)phenyl]-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126235534 |
| Molecular Formula | C36H32FN3O3 |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | (5Z)-1-[4-(1-adamantyl)phenyl]-5-[[1-[(3-fluorophenyl)methyl]indol-5-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)C(=O)/C1=C\c1ccc2c(ccn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C36H32FN3O3/c37-29-3-1-2-23(16-29)21-39-11-10-27-15-22(4-9-32(27)39)17-31-33(41)38-35(43)40(34(31)42)30-7-5-28(6-8-30)36-18-24-12-25(19-36)14-26(13-24)20-36/h1-11,15-17,24-26H,12-14,18-21H2,(H,38,41,43)/b31-17- |
| InChIKey | NPCDYEUXUZFIEZ-LJUMEUDFSA-N |
| XLogP | 6.96 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|