C27H29ClN2O5S2 — CID 126252617
2-[2-chloro-6-ethoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126252617) has the molecular formula C27H29ClN2O5S2 and a molecular weight of 561.13 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126252617 |
| Molecular Formula | C27H29ClN2O5S2 |
| Molecular Weight | 561.13 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(Z)-[4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(C[C@H]3CCCO3)C2=O)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C27H29ClN2O5S2/c1-4-33-22-12-18(13-23-26(32)30(27(36)37-23)14-19-6-5-9-34-19)11-20(28)25(22)35-15-24(31)29-21-8-7-16(2)10-17(21)3/h7-8,10-13,19H,4-6,9,14-15H2,1-3H3,(H,29,31)/b23-13-/t19-/m1/s1 |
| InChIKey | IJKMAVOFRCXHRE-AYBNGVQBSA-N |
| XLogP | 5.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.13 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|