C25H27ClN2O4S2 — CID 126263756
2-[2-chloro-6-ethoxy-4-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126263756) has the molecular formula C25H27ClN2O4S2 and a molecular weight of 519.09 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126263756 |
| Molecular Formula | C25H27ClN2O4S2 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[(Z)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | CCCN1C(=O)/C(=C/c2cc(Cl)c(OCC(=O)Nc3ccc(C)cc3C)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C25H27ClN2O4S2/c1-5-9-28-24(30)21(34-25(28)33)13-17-11-18(26)23(20(12-17)31-6-2)32-14-22(29)27-19-8-7-15(3)10-16(19)4/h7-8,10-13H,5-6,9,14H2,1-4H3,(H,27,29)/b21-13- |
| InChIKey | UBNADHVPYZQPIH-BKUYFWCQSA-N |
| XLogP | 5.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|