C24H25N3O2S — CID 126253475
(5E)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126253475) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is (5E)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126253475 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (5E)-5-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CC(C)c1ccc(N2C(=O)/C(=C/C=C/c3ccc(N(C)C)cc3)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C24H25N3O2S/c1-16(2)18-10-14-20(15-11-18)27-23(29)21(22(28)25-24(27)30)7-5-6-17-8-12-19(13-9-17)26(3)4/h5-16H,1-4H3,(H,25,28,30)/b6-5+,21-7+ |
| InChIKey | MDHBLKZBTKUOLX-FZTLNYMGSA-N |
| XLogP | 4.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|