C20H14N2O4S — CID 4237921
3-(5-cinnamylidene-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)benzoic acid (PubChem CID 4237921) has the molecular formula C20H14N2O4S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-(5-cinnamylidene-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)benzoic acid.
| Compound Name | 3-(5-cinnamylidene-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)benzoic acid |
|---|---|
| PubChem CID | 4237921 |
| Molecular Formula | C20H14N2O4S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 3-(5-cinnamylidene-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)benzoic acid |
| SMILES | O=C1NC(=S)N(c2cccc(C(=O)O)c2)C(=O)C1=CC=Cc1ccccc1 |
| InChI | InChI=1S/C20H14N2O4S/c23-17-16(11-4-8-13-6-2-1-3-7-13)18(24)22(20(27)21-17)15-10-5-9-14(12-15)19(25)26/h1-12H,(H,25,26)(H,21,23,27) |
| InChIKey | JCWCJOJZTXHZRL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|