C30H28ClIN2O4 — CID 126256639
N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(4-phenoxyanilino)methyl]phenoxy]acetamide (PubChem CID 126256639) has the molecular formula C30H28ClIN2O4 and a molecular weight of 642.92 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(4-phenoxyanilino)methyl]phenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(4-phenoxyanilino)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126256639 |
| Molecular Formula | C30H28ClIN2O4 |
| Molecular Weight | 642.92 g/mol |
| Exact Mass | 642.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-6-iodo-4-[(4-phenoxyanilino)methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNc2ccc(Oc3ccccc3)cc2)cc(I)c1OCC(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C30H28ClIN2O4/c1-3-36-28-16-21(18-33-22-11-13-25(14-12-22)38-24-7-5-4-6-8-24)15-27(32)30(28)37-19-29(35)34-23-10-9-20(2)26(31)17-23/h4-17,33H,3,18-19H2,1-2H3,(H,34,35) |
| InChIKey | MFSWPAZRNDFGOT-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.92 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|