C16H17ClINO2 — CID 126127801
4-[(3-chloro-4-methylanilino)methyl]-2-ethoxy-6-iodophenol (PubChem CID 126127801) has the molecular formula C16H17ClINO2 and a molecular weight of 417.67 g/mol. Its IUPAC name is 4-[(3-chloro-4-methylanilino)methyl]-2-ethoxy-6-iodophenol.
| Compound Name | 4-[(3-chloro-4-methylanilino)methyl]-2-ethoxy-6-iodophenol |
|---|---|
| PubChem CID | 126127801 |
| Molecular Formula | C16H17ClINO2 |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 4-[(3-chloro-4-methylanilino)methyl]-2-ethoxy-6-iodophenol |
| SMILES | CCOc1cc(CNc2ccc(C)c(Cl)c2)cc(I)c1O |
| InChI | InChI=1S/C16H17ClINO2/c1-3-21-15-7-11(6-14(18)16(15)20)9-19-12-5-4-10(2)13(17)8-12/h4-8,19-20H,3,9H2,1-2H3 |
| InChIKey | YAGJHVLZUXUMOO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|