C26H28ClIN2O4 — CID 126277621
N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-iodophenoxy]acetamide (PubChem CID 126277621) has the molecular formula C26H28ClIN2O4 and a molecular weight of 594.88 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-iodophenoxy]acetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-iodophenoxy]acetamide |
|---|---|
| PubChem CID | 126277621 |
| Molecular Formula | C26H28ClIN2O4 |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[2-ethoxy-4-[(4-ethoxyanilino)methyl]-6-iodophenoxy]acetamide |
| SMILES | CCOc1ccc(NCc2cc(I)c(OCC(=O)Nc3ccc(C)c(Cl)c3)c(OCC)c2)cc1 |
| InChI | InChI=1S/C26H28ClIN2O4/c1-4-32-21-10-8-19(9-11-21)29-15-18-12-23(28)26(24(13-18)33-5-2)34-16-25(31)30-20-7-6-17(3)22(27)14-20/h6-14,29H,4-5,15-16H2,1-3H3,(H,30,31) |
| InChIKey | LEUAMOYXMHCSRR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|