C19H21Cl3N2O3S — CID 126257708
3-[4-(tert-butylsulfamoyl)phenyl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 126257708) has the molecular formula C19H21Cl3N2O3S and a molecular weight of 463.81 g/mol. Its IUPAC name is 3-[4-(tert-butylsulfamoyl)phenyl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 3-[4-(tert-butylsulfamoyl)phenyl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 126257708 |
| Molecular Formula | C19H21Cl3N2O3S |
| Molecular Weight | 463.81 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 3-[4-(tert-butylsulfamoyl)phenyl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(CCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H21Cl3N2O3S/c1-19(2,3)24-28(26,27)13-7-4-12(5-8-13)6-9-18(25)23-17-11-15(21)14(20)10-16(17)22/h4-5,7-8,10-11,24H,6,9H2,1-3H3,(H,23,25) |
| InChIKey | RAEOZOXAZGXLMY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|