C15H12BrCl3N2O3S — CID 17192350
3-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 17192350) has the molecular formula C15H12BrCl3N2O3S and a molecular weight of 486.60 g/mol. Its IUPAC name is 3-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | 3-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 17192350 |
| Molecular Formula | C15H12BrCl3N2O3S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 483.88 |
| IUPAC Name | 3-[(4-bromophenyl)sulfonylamino]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(Br)cc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H12BrCl3N2O3S/c16-9-1-3-10(4-2-9)25(23,24)20-6-5-15(22)21-14-8-12(18)11(17)7-13(14)19/h1-4,7-8,20H,5-6H2,(H,21,22) |
| InChIKey | NBXHGLVTBQJVBE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|