C24H17Cl2N3O4 — CID 126257728
2-[2-chloro-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 126257728) has the molecular formula C24H17Cl2N3O4 and a molecular weight of 482.32 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126257728 |
| Molecular Formula | C24H17Cl2N3O4 |
| Molecular Weight | 482.32 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-2-cyano-2-(4-nitrophenyl)ethenyl]phenoxy]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=C(\C#N)c3ccc([N+](=O)[O-])cc3)cc2Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl2N3O4/c1-15-2-6-19(12-21(15)25)28-24(30)14-33-23-9-3-16(11-22(23)26)10-18(13-27)17-4-7-20(8-5-17)29(31)32/h2-12H,14H2,1H3,(H,28,30)/b18-10+ |
| InChIKey | AFEWGOAPGCRTAV-VCHYOVAHSA-N |
| XLogP | 6.29 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.32 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|