C26H27ClN2O5S — CID 126258422
methyl 2-[4-(4-benzhydrylpiperazin-1-yl)sulfonyl-2-chlorophenoxy]acetate (PubChem CID 126258422) has the molecular formula C26H27ClN2O5S and a molecular weight of 515.03 g/mol. Its IUPAC name is methyl 2-[4-(4-benzhydrylpiperazin-1-yl)sulfonyl-2-chlorophenoxy]acetate.
| Compound Name | methyl 2-[4-(4-benzhydrylpiperazin-1-yl)sulfonyl-2-chlorophenoxy]acetate |
|---|---|
| PubChem CID | 126258422 |
| Molecular Formula | C26H27ClN2O5S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | methyl 2-[4-(4-benzhydrylpiperazin-1-yl)sulfonyl-2-chlorophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C26H27ClN2O5S/c1-33-25(30)19-34-24-13-12-22(18-23(24)27)35(31,32)29-16-14-28(15-17-29)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,18,26H,14-17,19H2,1H3 |
| InChIKey | WXLQUMBFZCBVNT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |