C19H22N2O6S — CID 126259769
ethyl 2-[(5E)-5-[(2-methoxy-4-morpholin-4-ylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126259769) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[(2-methoxy-4-morpholin-4-ylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(5E)-5-[(2-methoxy-4-morpholin-4-ylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126259769 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | ethyl 2-[(5E)-5-[(2-methoxy-4-morpholin-4-ylphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)S/C(=C/c2ccc(N3CCOCC3)cc2OC)C1=O |
| InChI | InChI=1S/C19H22N2O6S/c1-3-27-17(22)12-21-18(23)16(28-19(21)24)10-13-4-5-14(11-15(13)25-2)20-6-8-26-9-7-20/h4-5,10-11H,3,6-9,12H2,1-2H3/b16-10+ |
| InChIKey | ZYOMKJLLYVQPHS-MHWRWJLKSA-N |
| XLogP | 2.13 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|