C11H14BrNO2 — CID 12626088
N-[2-(2-bromo-5-methoxyphenyl)ethyl]acetamide (PubChem CID 12626088) has the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. Its IUPAC name is N-[2-(2-bromo-5-methoxyphenyl)ethyl]acetamide.
| Compound Name | N-[2-(2-bromo-5-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 12626088 |
| Molecular Formula | C11H14BrNO2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | N-[2-(2-bromo-5-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(Br)c(CCNC(C)=O)c1 |
| InChI | InChI=1S/C11H14BrNO2/c1-8(14)13-6-5-9-7-10(15-2)3-4-11(9)12/h3-4,7H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | VBYHCEHRVNCVOQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |