C29H27F3N4O5 — CID 126275867
(3S)-1-(4-ethoxyphenyl)-5-oxo-N-[(Z)-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]pyrrolidine-3-carboxamide (PubChem CID 126275867) has the molecular formula C29H27F3N4O5 and a molecular weight of 568.55 g/mol. Its IUPAC name is (3S)-1-(4-ethoxyphenyl)-5-oxo-N-[(Z)-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(4-ethoxyphenyl)-5-oxo-N-[(Z)-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126275867 |
| Molecular Formula | C29H27F3N4O5 |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.19 |
| IUPAC Name | (3S)-1-(4-ethoxyphenyl)-5-oxo-N-[(Z)-[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]phenyl]methylideneamino]pyrrolidine-3-carboxamide |
| SMILES | CCOc1ccc(N2C[C@@H](C(=O)N/N=C\c3ccc(OCC(=O)Nc4cccc(C(F)(F)F)c4)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C29H27F3N4O5/c1-2-40-24-12-8-23(9-13-24)36-17-20(14-27(36)38)28(39)35-33-16-19-6-10-25(11-7-19)41-18-26(37)34-22-5-3-4-21(15-22)29(30,31)32/h3-13,15-16,20H,2,14,17-18H2,1H3,(H,34,37)(H,35,39)/b33-16-/t20-/m0/s1 |
| InChIKey | LVFSQYGVLLBNBJ-HHGZQQQNSA-N |
| XLogP | 4.62 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|