C29H19N3O5 — CID 126286501
2-[1-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxyacetic acid (PubChem CID 126286501) has the molecular formula C29H19N3O5 and a molecular weight of 489.49 g/mol. Its IUPAC name is 2-[1-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxyacetic acid.
| Compound Name | 2-[1-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxyacetic acid |
|---|---|
| PubChem CID | 126286501 |
| Molecular Formula | C29H19N3O5 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 2-[1-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]naphthalen-2-yl]oxyacetic acid |
| SMILES | O=C(O)COc1ccc2ccccc2c1C=Nn1c(-c2cc3ccccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H19N3O5/c33-27(34)17-36-25-14-13-18-7-1-3-9-20(18)22(25)16-30-32-28(26-15-19-8-2-6-12-24(19)37-26)31-23-11-5-4-10-21(23)29(32)35/h1-16H,17H2,(H,33,34) |
| InChIKey | KZTPGVDUWRQMNV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|