C25H18N4O4 — CID 4009036
2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide (PubChem CID 4009036) has the molecular formula C25H18N4O4 and a molecular weight of 438.44 g/mol. Its IUPAC name is 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide.
| Compound Name | 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4009036 |
| Molecular Formula | C25H18N4O4 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccccc1C=Nn1c(-c2cc3ccccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H18N4O4/c26-23(30)15-32-20-11-5-2-8-17(20)14-27-29-24(22-13-16-7-1-6-12-21(16)33-22)28-19-10-4-3-9-18(19)25(29)31/h1-14H,15H2,(H2,26,30) |
| InChIKey | MVKHTTRYCXYQQK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|