C25H17N3O5 — CID 126310485
2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid (PubChem CID 126310485) has the molecular formula C25H17N3O5 and a molecular weight of 439.43 g/mol. Its IUPAC name is 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126310485 |
| Molecular Formula | C25H17N3O5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 2-[2-[[2-(1-benzofuran-2-yl)-4-oxoquinazolin-3-yl]iminomethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1C=Nn1c(-c2cc3ccccc3o2)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H17N3O5/c29-23(30)15-32-20-11-5-2-8-17(20)14-26-28-24(22-13-16-7-1-6-12-21(16)33-22)27-19-10-4-3-9-18(19)25(28)31/h1-14H,15H2,(H,29,30) |
| InChIKey | JQPVBAGVQIBPJH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|