C29H28N4O7 — CID 126297884
methyl 2-[2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]acetate (PubChem CID 126297884) has the molecular formula C29H28N4O7 and a molecular weight of 544.56 g/mol. Its IUPAC name is methyl 2-[2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]acetate.
| Compound Name | methyl 2-[2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 126297884 |
| Molecular Formula | C29H28N4O7 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | methyl 2-[2-[[2-(4-methoxy-2-methyl-5-propan-2-ylphenyl)-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]acetate |
| SMILES | COC(=O)COc1ccc([N+](=O)[O-])cc1C=Nn1c(-c2cc(C(C)C)c(OC)cc2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C29H28N4O7/c1-17(2)22-14-23(18(3)12-26(22)38-4)28-31-24-9-7-6-8-21(24)29(35)32(28)30-15-19-13-20(33(36)37)10-11-25(19)40-16-27(34)39-5/h6-15,17H,16H2,1-5H3 |
| InChIKey | YIZTXPRLZUOPNF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 135.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|