C31H21N3O5 — CID 126303593
3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-(1-benzofuran-2-yl)quinazolin-4-one (PubChem CID 126303593) has the molecular formula C31H21N3O5 and a molecular weight of 515.53 g/mol. Its IUPAC name is 3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-(1-benzofuran-2-yl)quinazolin-4-one.
| Compound Name | 3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-(1-benzofuran-2-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 126303593 |
| Molecular Formula | C31H21N3O5 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 3-[[3-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-2-(1-benzofuran-2-yl)quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3ccccc3o2)n1N=Cc1cccc(OCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C31H21N3O5/c35-31-24-9-2-3-10-25(24)33-30(29-16-22-7-1-4-11-26(22)39-29)34(31)32-17-20-6-5-8-23(14-20)36-18-21-12-13-27-28(15-21)38-19-37-27/h1-17H,18-19H2 |
| InChIKey | WQIQEBPDJLHTCG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 88.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|