C30H20FN3O3 — CID 126308764
2-(1-benzofuran-2-yl)-3-[[3-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126308764) has the molecular formula C30H20FN3O3 and a molecular weight of 489.51 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[[3-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[[3-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126308764 |
| Molecular Formula | C30H20FN3O3 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[[3-[(3-fluorophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(-c2cc3ccccc3o2)n1N=Cc1cccc(OCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C30H20FN3O3/c31-23-10-5-8-21(15-23)19-36-24-11-6-7-20(16-24)18-32-34-29(28-17-22-9-1-4-14-27(22)37-28)33-26-13-3-2-12-25(26)30(34)35/h1-18H,19H2 |
| InChIKey | GNEFVLOVQYPFGV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|