C23H23BrN4O6 — CID 126316735
propan-2-yl 2-[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate (PubChem CID 126316735) has the molecular formula C23H23BrN4O6 and a molecular weight of 531.36 g/mol. Its IUPAC name is propan-2-yl 2-[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate.
| Compound Name | propan-2-yl 2-[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 126316735 |
| Molecular Formula | C23H23BrN4O6 |
| Molecular Weight | 531.36 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | propan-2-yl 2-[2-[(6-bromo-4-oxo-2-propylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]acetate |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc([N+](=O)[O-])c1OCC(=O)OC(C)C |
| InChI | InChI=1S/C23H23BrN4O6/c1-4-6-20-26-18-10-9-16(24)11-17(18)23(30)27(20)25-12-15-7-5-8-19(28(31)32)22(15)33-13-21(29)34-14(2)3/h5,7-12,14H,4,6,13H2,1-3H3 |
| InChIKey | BBENGZIRLGGFPO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|