C26H22BrN5O5 — CID 126298995
2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126298995) has the molecular formula C26H22BrN5O5 and a molecular weight of 564.40 g/mol. Its IUPAC name is 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126298995 |
| Molecular Formula | C26H22BrN5O5 |
| Molecular Weight | 564.40 g/mol |
| Exact Mass | 563.08 |
| IUPAC Name | 2-[2-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc([N+](=O)[O-])c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H22BrN5O5/c1-3-23-30-21-12-9-18(27)13-20(21)26(34)31(23)28-14-17-5-4-6-22(32(35)36)25(17)37-15-24(33)29-19-10-7-16(2)8-11-19/h4-14H,3,15H2,1-2H3,(H,29,33) |
| InChIKey | ICPAREFLMCWFED-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|