C28H26BrN5O5 — CID 126317510
2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126317510) has the molecular formula C28H26BrN5O5 and a molecular weight of 592.45 g/mol. Its IUPAC name is 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126317510 |
| Molecular Formula | C28H26BrN5O5 |
| Molecular Weight | 592.45 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 2-[2-[(6-bromo-2-butyl-4-oxoquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc([N+](=O)[O-])c1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C28H26BrN5O5/c1-3-4-12-25-31-23-14-13-20(29)15-21(23)28(36)33(25)30-16-19-9-7-11-24(34(37)38)27(19)39-17-26(35)32-22-10-6-5-8-18(22)2/h5-11,13-16H,3-4,12,17H2,1-2H3,(H,32,35) |
| InChIKey | FORDNWHLAAIVRF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|