C18H17N3O3S — CID 126321728
N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126321728) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126321728 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[(5E)-2,4-dioxo-5-(1H-pyrrol-2-ylmethylidene)-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1C(=O)S/C(=C/c2ccc[nH]2)C1=O |
| InChI | InChI=1S/C18H17N3O3S/c1-11-5-3-6-12(2)16(11)20-15(22)10-21-17(23)14(25-18(21)24)9-13-7-4-8-19-13/h3-9,19H,10H2,1-2H3,(H,20,22)/b14-9+ |
| InChIKey | JFXFEFJPXKUDCG-NTEUORMPSA-N |
| XLogP | 3.31 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|