C17H13FN2O2S2 — CID 126334949
3-[(E)-[2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126334949) has the molecular formula C17H13FN2O2S2 and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-[(E)-[2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(E)-[2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126334949 |
| Molecular Formula | C17H13FN2O2S2 |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 3-[(E)-[2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=S)N1/N=C/c1ccccc1OCc1ccccc1F |
| InChI | InChI=1S/C17H13FN2O2S2/c18-14-7-3-1-6-13(14)10-22-15-8-4-2-5-12(15)9-19-20-16(21)11-24-17(20)23/h1-9H,10-11H2/b19-9+ |
| InChIKey | BBEFTBDTMVHFJU-DJKKODMXSA-N |
| XLogP | 3.60 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|