C13H9N3OS2 — CID 4893215
3-(quinolin-8-ylmethylideneamino)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4893215) has the molecular formula C13H9N3OS2 and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-(quinolin-8-ylmethylideneamino)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(quinolin-8-ylmethylideneamino)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4893215 |
| Molecular Formula | C13H9N3OS2 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 3-(quinolin-8-ylmethylideneamino)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(=S)N1N=Cc1cccc2cccnc12 |
| InChI | InChI=1S/C13H9N3OS2/c17-11-8-19-13(18)16(11)15-7-10-4-1-3-9-5-2-6-14-12(9)10/h1-7H,8H2 |
| InChIKey | RCPAWBQGFVLLQW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|