C13H12N2O5S2 — CID 126356447
2-[2-methoxy-6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetic acid (PubChem CID 126356447) has the molecular formula C13H12N2O5S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[2-methoxy-6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methoxy-6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126356447 |
| Molecular Formula | C13H12N2O5S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 2-[2-methoxy-6-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetic acid |
| SMILES | COc1cccc(/C=N/N2C(=O)CSC2=S)c1OCC(=O)O |
| InChI | InChI=1S/C13H12N2O5S2/c1-19-9-4-2-3-8(12(9)20-6-11(17)18)5-14-15-10(16)7-22-13(15)21/h2-5H,6-7H2,1H3,(H,17,18)/b14-5+ |
| InChIKey | SGAXPPBUWZKRRT-LHHJGKSTSA-N |
| XLogP | 1.35 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|