C22H18IN3O3S — CID 126336466
2-[(5Z)-5-[(1,2-dimethylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide (PubChem CID 126336466) has the molecular formula C22H18IN3O3S and a molecular weight of 531.38 g/mol. Its IUPAC name is 2-[(5Z)-5-[(1,2-dimethylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(1,2-dimethylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126336466 |
| Molecular Formula | C22H18IN3O3S |
| Molecular Weight | 531.38 g/mol |
| Exact Mass | 531.01 |
| IUPAC Name | 2-[(5Z)-5-[(1,2-dimethylindol-3-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-iodophenyl)acetamide |
| SMILES | Cc1c(/C=C2\SC(=O)N(CC(=O)Nc3ccc(I)cc3)C2=O)c2ccccc2n1C |
| InChI | InChI=1S/C22H18IN3O3S/c1-13-17(16-5-3-4-6-18(16)25(13)2)11-19-21(28)26(22(29)30-19)12-20(27)24-15-9-7-14(23)8-10-15/h3-11H,12H2,1-2H3,(H,24,27)/b19-11- |
| InChIKey | LBSSVOLKHGDAIH-ODLFYWEKSA-N |
| XLogP | 4.77 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|