C21H25FN4O3S — CID 126336951
N-[(1-benzylpiperidin-4-ylidene)amino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide (PubChem CID 126336951) has the molecular formula C21H25FN4O3S and a molecular weight of 432.52 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-ylidene)amino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126336951 |
| Molecular Formula | C21H25FN4O3S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[(1-benzylpiperidin-4-ylidene)amino]-2-(2-fluoro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NN=C1CCN(Cc2ccccc2)CC1)c1ccccc1F |
| InChI | InChI=1S/C21H25FN4O3S/c1-30(28,29)26(20-10-6-5-9-19(20)22)16-21(27)24-23-18-11-13-25(14-12-18)15-17-7-3-2-4-8-17/h2-10H,11-16H2,1H3,(H,24,27) |
| InChIKey | MVXCNVVYHUXUMW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|