C27H26ClF3N4O3S — CID 126349041
2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(1-benzylpiperidin-4-ylidene)amino]acetamide (PubChem CID 126349041) has the molecular formula C27H26ClF3N4O3S and a molecular weight of 579.04 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(1-benzylpiperidin-4-ylidene)amino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(1-benzylpiperidin-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 126349041 |
| Molecular Formula | C27H26ClF3N4O3S |
| Molecular Weight | 579.04 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(1-benzylpiperidin-4-ylidene)amino]acetamide |
| SMILES | O=C(CN(c1cc(C(F)(F)F)ccc1Cl)S(=O)(=O)c1ccccc1)NN=C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H26ClF3N4O3S/c28-24-12-11-21(27(29,30)31)17-25(24)35(39(37,38)23-9-5-2-6-10-23)19-26(36)33-32-22-13-15-34(16-14-22)18-20-7-3-1-4-8-20/h1-12,17H,13-16,18-19H2,(H,33,36) |
| InChIKey | DEZOTDXAVWLELC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|