C30H34ClN5O5 — CID 126337519
5-[(4E)-4-[[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid (PubChem CID 126337519) has the molecular formula C30H34ClN5O5 and a molecular weight of 580.09 g/mol. Its IUPAC name is 5-[(4E)-4-[[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid.
| Compound Name | 5-[(4E)-4-[[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 126337519 |
| Molecular Formula | C30H34ClN5O5 |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | 5-[(4E)-4-[[2,4-bis[(2R)-2-methylpiperidin-1-yl]-5-nitrophenyl]methylidene]-3-methyl-5-oxopyrazol-1-yl]-2-chlorobenzoic acid |
| SMILES | CC1=NN(c2ccc(Cl)c(C(=O)O)c2)C(=O)/C1=C/c1cc([N+](=O)[O-])c(N2CCCC[C@H]2C)cc1N1CCCC[C@H]1C |
| InChI | InChI=1S/C30H34ClN5O5/c1-18-8-4-6-12-33(18)26-17-27(34-13-7-5-9-19(34)2)28(36(40)41)15-21(26)14-23-20(3)32-35(29(23)37)22-10-11-25(31)24(16-22)30(38)39/h10-11,14-19H,4-9,12-13H2,1-3H3,(H,38,39)/b23-14+/t18-,19-/m1/s1 |
| InChIKey | CAANCQSKAFKEMZ-VOLNOZNDSA-N |
| XLogP | 6.51 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|