C22H18Br2N4O — CID 126337704
6-bromo-3-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126337704) has the molecular formula C22H18Br2N4O and a molecular weight of 514.22 g/mol. Its IUPAC name is 6-bromo-3-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126337704 |
| Molecular Formula | C22H18Br2N4O |
| Molecular Weight | 514.22 g/mol |
| Exact Mass | 511.98 |
| IUPAC Name | 6-bromo-3-[[1-(4-bromophenyl)pyrrol-2-yl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cccn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H18Br2N4O/c1-2-4-21-26-20-11-8-16(24)13-19(20)22(29)28(21)25-14-18-5-3-12-27(18)17-9-6-15(23)7-10-17/h3,5-14H,2,4H2,1H3 |
| InChIKey | GEAOFDOBGWODHZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.22 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|