C19H15ClN2O4S2 — CID 126347854
(5Z)-5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-propyl-1,3-thiazolidine-2,4-dione (PubChem CID 126347854) has the molecular formula C19H15ClN2O4S2 and a molecular weight of 434.93 g/mol. Its IUPAC name is (5Z)-5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-propyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-propyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126347854 |
| Molecular Formula | C19H15ClN2O4S2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | (5Z)-5-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylidene]-3-propyl-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN1C(=O)S/C(=C\c2ccc(Sc3ccc(Cl)cc3)c([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C19H15ClN2O4S2/c1-2-9-21-18(23)17(28-19(21)24)11-12-3-8-16(15(10-12)22(25)26)27-14-6-4-13(20)5-7-14/h3-8,10-11H,2,9H2,1H3/b17-11- |
| InChIKey | FSRVSSWZJLFYAC-BOPFTXTBSA-N |
| XLogP | 5.85 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|