C19H15BrCl2N2O3S2 — CID 126350323
3-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126350323) has the molecular formula C19H15BrCl2N2O3S2 and a molecular weight of 534.28 g/mol. Its IUPAC name is 3-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126350323 |
| Molecular Formula | C19H15BrCl2N2O3S2 |
| Molecular Weight | 534.28 g/mol |
| Exact Mass | 531.91 |
| IUPAC Name | 3-[(E)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylideneamino]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=N/N2C(=O)CSC2=S)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15BrCl2N2O3S2/c1-2-26-16-7-12(8-23-24-17(25)10-29-19(24)28)5-13(20)18(16)27-9-11-3-4-14(21)15(22)6-11/h3-8H,2,9-10H2,1H3/b23-8+ |
| InChIKey | IRGUHZNAPHHARC-LIMNOBDPSA-N |
| XLogP | 5.93 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.28 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|