C14H12Cl2N2O4S2 — CID 126334141
ethyl 2-[2,6-dichloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetate (PubChem CID 126334141) has the molecular formula C14H12Cl2N2O4S2 and a molecular weight of 407.30 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126334141 |
| Molecular Formula | C14H12Cl2N2O4S2 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(Z)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)iminomethyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=N\N2C(=O)CSC2=S)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O4S2/c1-2-21-12(20)6-22-13-9(15)3-8(4-10(13)16)5-17-18-11(19)7-24-14(18)23/h3-5H,2,6-7H2,1H3/b17-5- |
| InChIKey | OYMDOWLCAADMCK-ZWSORDCHSA-N |
| XLogP | 3.13 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|