C23H24Cl2N4OS — CID 126366407
N-[(1R)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide (PubChem CID 126366407) has the molecular formula C23H24Cl2N4OS and a molecular weight of 475.45 g/mol. Its IUPAC name is N-[(1R)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide.
| Compound Name | N-[(1R)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
|---|---|
| PubChem CID | 126366407 |
| Molecular Formula | C23H24Cl2N4OS |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | N-[(1R)-1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-2-methylpropyl]benzamide |
| SMILES | C=CCn1c(SCc2ccc(Cl)cc2Cl)nnc1[C@H](NC(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C23H24Cl2N4OS/c1-4-12-29-21(20(15(2)3)26-22(30)16-8-6-5-7-9-16)27-28-23(29)31-14-17-10-11-18(24)13-19(17)25/h4-11,13,15,20H,1,12,14H2,2-3H3,(H,26,30)/t20-/m1/s1 |
| InChIKey | SRGXCXFOUJYKLS-HXUWFJFHSA-N |
| XLogP | 6.19 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|