C23H18O4 — CID 126374428
ethyl 3-[5-[(E)-(3-oxo-1H-inden-2-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 126374428) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 3-[5-[(E)-(3-oxo-1H-inden-2-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 3-[5-[(E)-(3-oxo-1H-inden-2-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126374428 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | ethyl 3-[5-[(E)-(3-oxo-1H-inden-2-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccc(/C=C3\Cc4ccccc4C3=O)o2)c1 |
| InChI | InChI=1S/C23H18O4/c1-2-26-23(25)17-8-5-7-16(13-17)21-11-10-19(27-21)14-18-12-15-6-3-4-9-20(15)22(18)24/h3-11,13-14H,2,12H2,1H3/b18-14+ |
| InChIKey | XXJFDNRCXBQSGJ-NBVRZTHBSA-N |
| XLogP | 4.95 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|