C23H21ClFN3O2 — CID 126383011
2-[2-chloro-4-[[4-(dimethylamino)phenyl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide (PubChem CID 126383011) has the molecular formula C23H21ClFN3O2 and a molecular weight of 425.89 g/mol. Its IUPAC name is 2-[2-chloro-4-[[4-(dimethylamino)phenyl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[2-chloro-4-[[4-(dimethylamino)phenyl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126383011 |
| Molecular Formula | C23H21ClFN3O2 |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 2-[2-chloro-4-[[4-(dimethylamino)phenyl]iminomethyl]phenoxy]-N-(2-fluorophenyl)acetamide |
| SMILES | CN(C)c1ccc(/N=C/c2ccc(OCC(=O)Nc3ccccc3F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H21ClFN3O2/c1-28(2)18-10-8-17(9-11-18)26-14-16-7-12-22(19(24)13-16)30-15-23(29)27-21-6-4-3-5-20(21)25/h3-14H,15H2,1-2H3,(H,27,29)/b26-14+ |
| InChIKey | PCGGRRBJONWKJP-VULFUBBASA-N |
| XLogP | 5.31 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|