C29H27NO5S — CID 126384777
methyl (4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methyl-1-(3-methylsulfanylphenyl)-5-oxopyrrole-3-carboxylate (PubChem CID 126384777) has the molecular formula C29H27NO5S and a molecular weight of 501.60 g/mol. Its IUPAC name is methyl (4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methyl-1-(3-methylsulfanylphenyl)-5-oxopyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methyl-1-(3-methylsulfanylphenyl)-5-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 126384777 |
| Molecular Formula | C29H27NO5S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | methyl (4Z)-4-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-methyl-1-(3-methylsulfanylphenyl)-5-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2cccc(SC)c2)C(=O)/C1=C\c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C29H27NO5S/c1-19-27(29(32)34-3)24(28(31)30(19)22-11-8-12-23(17-22)36-4)15-21-13-14-25(26(16-21)33-2)35-18-20-9-6-5-7-10-20/h5-17H,18H2,1-4H3/b24-15- |
| InChIKey | KDAFWFMMQOYVSR-IWIPYMOSSA-N |
| XLogP | 5.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|