C26H27N3O8 — CID 126388202
(1R,2S,3R,4R)-3-[[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 126388202) has the molecular formula C26H27N3O8 and a molecular weight of 509.52 g/mol. Its IUPAC name is (1R,2S,3R,4R)-3-[[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4R)-3-[[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 126388202 |
| Molecular Formula | C26H27N3O8 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | (1R,2S,3R,4R)-3-[[[4-[(3,4,5-trimethoxybenzoyl)amino]benzoyl]amino]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)NNC(=O)[C@H]3[C@@H](C(=O)O)[C@H]4C=C[C@H]3C4)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27N3O8/c1-35-18-11-16(12-19(36-2)22(18)37-3)23(30)27-17-8-6-13(7-9-17)24(31)28-29-25(32)20-14-4-5-15(10-14)21(20)26(33)34/h4-9,11-12,14-15,20-21H,10H2,1-3H3,(H,27,30)(H,28,31)(H,29,32)(H,33,34)/t14-,15-,20+,21-/m0/s1 |
| InChIKey | YNHBTSDIHHLSRE-YJPXFSGGSA-N |
| XLogP | 2.25 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|