C32H27N3O12 — CID 126389609
(2S,3S)-4-[2-[4-(furan-2-carbonylamino)benzoyl]hydrazinyl]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid (PubChem CID 126389609) has the molecular formula C32H27N3O12 and a molecular weight of 645.58 g/mol. Its IUPAC name is (2S,3S)-4-[2-[4-(furan-2-carbonylamino)benzoyl]hydrazinyl]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S,3S)-4-[2-[4-(furan-2-carbonylamino)benzoyl]hydrazinyl]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 126389609 |
| Molecular Formula | C32H27N3O12 |
| Molecular Weight | 645.58 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | (2S,3S)-4-[2-[4-(furan-2-carbonylamino)benzoyl]hydrazinyl]-2,3-bis[(3-methoxybenzoyl)oxy]-4-oxobutanoic acid |
| SMILES | COc1cccc(C(=O)O[C@H](C(=O)O)[C@H](OC(=O)c2cccc(OC)c2)C(=O)NNC(=O)c2ccc(NC(=O)c3ccco3)cc2)c1 |
| InChI | InChI=1S/C32H27N3O12/c1-43-22-8-3-6-19(16-22)31(41)46-25(26(30(39)40)47-32(42)20-7-4-9-23(17-20)44-2)29(38)35-34-27(36)18-11-13-21(14-12-18)33-28(37)24-10-5-15-45-24/h3-17,25-26H,1-2H3,(H,33,37)(H,34,36)(H,35,38)(H,39,40)/t25-,26-/m0/s1 |
| InChIKey | GTNGUZNUHNFOAZ-UIOOFZCWSA-N |
| XLogP | 2.85 |
| TPSA | 208.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|