C24H23N3O6 — CID 126392815
(1R,2R,3R,4R)-4-methyl-3-[[[4-[(4-methylbenzoyl)amino]benzoyl]amino]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 126392815) has the molecular formula C24H23N3O6 and a molecular weight of 449.46 g/mol. Its IUPAC name is (1R,2R,3R,4R)-4-methyl-3-[[[4-[(4-methylbenzoyl)amino]benzoyl]amino]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-4-methyl-3-[[[4-[(4-methylbenzoyl)amino]benzoyl]amino]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 126392815 |
| Molecular Formula | C24H23N3O6 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (1R,2R,3R,4R)-4-methyl-3-[[[4-[(4-methylbenzoyl)amino]benzoyl]amino]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)NNC(=O)[C@@H]3[C@@H](C(=O)O)[C@H]4C=C[C@@]3(C)O4)cc2)cc1 |
| InChI | InChI=1S/C24H23N3O6/c1-13-3-5-14(6-4-13)20(28)25-16-9-7-15(8-10-16)21(29)26-27-22(30)19-18(23(31)32)17-11-12-24(19,2)33-17/h3-12,17-19H,1-2H3,(H,25,28)(H,26,29)(H,27,30)(H,31,32)/t17-,18+,19+,24-/m1/s1 |
| InChIKey | TVXOUHPAMCPPRO-XMODTWTHSA-N |
| XLogP | 2.05 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|