C21H19N3O7 — CID 3442609
3-[[[4-(furan-2-carbonylamino)benzoyl]amino]carbamoyl]-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 3442609) has the molecular formula C21H19N3O7 and a molecular weight of 425.40 g/mol. Its IUPAC name is 3-[[[4-(furan-2-carbonylamino)benzoyl]amino]carbamoyl]-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 3-[[[4-(furan-2-carbonylamino)benzoyl]amino]carbamoyl]-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 3442609 |
| Molecular Formula | C21H19N3O7 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 3-[[[4-(furan-2-carbonylamino)benzoyl]amino]carbamoyl]-4-methyl-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | CC12C=CC(O1)C(C(=O)O)C2C(=O)NNC(=O)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H19N3O7/c1-21-9-8-13(31-21)15(20(28)29)16(21)19(27)24-23-17(25)11-4-6-12(7-5-11)22-18(26)14-3-2-10-30-14/h2-10,13,15-16H,1H3,(H,22,26)(H,23,25)(H,24,27)(H,28,29) |
| InChIKey | KNNQWKTYXFUFIF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|