C18H18I2N2O4 — CID 126395066
N-[(Z)-(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-hydroxy-4-methoxybenzamide (PubChem CID 126395066) has the molecular formula C18H18I2N2O4 and a molecular weight of 580.16 g/mol. Its IUPAC name is N-[(Z)-(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[(Z)-(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126395066 |
| Molecular Formula | C18H18I2N2O4 |
| Molecular Weight | 580.16 g/mol |
| Exact Mass | 579.94 |
| IUPAC Name | N-[(Z)-(3,5-diiodo-4-propan-2-yloxyphenyl)methylideneamino]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2cc(I)c(OC(C)C)c(I)c2)c(O)c1 |
| InChI | InChI=1S/C18H18I2N2O4/c1-10(2)26-17-14(19)6-11(7-15(17)20)9-21-22-18(24)13-5-4-12(25-3)8-16(13)23/h4-10,23H,1-3H3,(H,22,24)/b21-9- |
| InChIKey | DSFFYHMMFQYSFK-NKVSQWTQSA-N |
| XLogP | 4.16 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.16 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|