C23H16Cl2FNO2 — CID 126398458
(E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126398458) has the molecular formula C23H16Cl2FNO2 and a molecular weight of 428.29 g/mol. Its IUPAC name is (E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126398458 |
| Molecular Formula | C23H16Cl2FNO2 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2cccc(F)c2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H16Cl2FNO2/c1-28-23-10-15(9-18(13-27)16-3-2-4-20(26)11-16)5-8-22(23)29-14-17-6-7-19(24)12-21(17)25/h2-12H,14H2,1H3/b18-9- |
| InChIKey | TTZIERNKOUUPEC-NVMNQCDNSA-N |
| XLogP | 6.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|