C26H16Cl2FNO — CID 126398125
(E)-3-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126398125) has the molecular formula C26H16Cl2FNO and a molecular weight of 448.32 g/mol. Its IUPAC name is (E)-3-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126398125 |
| Molecular Formula | C26H16Cl2FNO |
| Molecular Weight | 448.32 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | (E)-3-[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1c(OCc2ccc(Cl)cc2Cl)ccc2ccccc12)c1cccc(F)c1 |
| InChI | InChI=1S/C26H16Cl2FNO/c27-21-10-8-19(25(28)14-21)16-31-26-11-9-17-4-1-2-7-23(17)24(26)13-20(15-30)18-5-3-6-22(29)12-18/h1-14H,16H2/b20-13- |
| InChIKey | QWCFBWLIHJXNSG-MOSHPQCFSA-N |
| XLogP | 7.93 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.32 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|