C18H21N — CID 12640141
2,3,3-trimethyl-4-phenyl-1,4-dihydroisoquinoline (PubChem CID 12640141) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is 2,3,3-trimethyl-4-phenyl-1,4-dihydroisoquinoline.
| Compound Name | 2,3,3-trimethyl-4-phenyl-1,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 12640141 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2,3,3-trimethyl-4-phenyl-1,4-dihydroisoquinoline |
| SMILES | CN1Cc2ccccc2C(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C18H21N/c1-18(2)17(14-9-5-4-6-10-14)16-12-8-7-11-15(16)13-19(18)3/h4-12,17H,13H2,1-3H3 |
| InChIKey | NAGTYLZLBKAWTJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |