C16H16N2S — CID 129363287
(5S)-2-methyl-5-phenyl-4,5-dihydro-1H-2,4-benzodiazepine-3-thione (PubChem CID 129363287) has the molecular formula C16H16N2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (5S)-2-methyl-5-phenyl-4,5-dihydro-1H-2,4-benzodiazepine-3-thione.
| Compound Name | (5S)-2-methyl-5-phenyl-4,5-dihydro-1H-2,4-benzodiazepine-3-thione |
|---|---|
| PubChem CID | 129363287 |
| Molecular Formula | C16H16N2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (5S)-2-methyl-5-phenyl-4,5-dihydro-1H-2,4-benzodiazepine-3-thione |
| SMILES | CN1Cc2ccccc2[C@H](c2ccccc2)NC1=S |
| InChI | InChI=1S/C16H16N2S/c1-18-11-13-9-5-6-10-14(13)15(17-16(18)19)12-7-3-2-4-8-12/h2-10,15H,11H2,1H3,(H,17,19)/t15-/m0/s1 |
| InChIKey | DFOALTHQNQSMJA-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|